answersLogoWhite

0

The position of double bond is different. CH3-CH=CH-CH2-CH2-CH3 is 2-hexene CH3-CH2-CH=CH-CH2-CH3 is 3-hexene

User Avatar

Wiki User

13y ago

What else can I help you with?

Related Questions

What is the chemical formula for 2-methyl-2hexene?

A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.


What is difference between as on and as at?

difference between as on and as at


What are the differences between California and Florida?

What is the difference between Florida and California What is the difference between Florida and California


What is the difference between physician and doctor?

what's the difference between physician and doctorwhat's the difference between physician and doctor what's the difference between physician and doctor


What difference between paging?

Difference between paging and what?


What is the difference between difference and difference?

The answer of difference


What is the difference between an enterprise and association what is the difference between an pvt ltd and ltd.?

difference between enterprise and corporation


What is the difference between an enterprise and association what is the difference between an pvt ltd and ltd?

difference between enterprise and corporation


What is the difference between a samurai and shogun?

The difference between a shogun and a samurai is like the difference between a king and a knight.


What is the difference between the 1993 Honda accord?

Difference between it and what?


What is the difference between polyethylene and polyester?

what is the main difference between polyethylene and polyesters what is the main difference between polyethylene and polyesters


What is the difference between disneyworld and Disneyland?

The difference between Disneyland and Disneyworld is that Disneyland is in California and Florida is in Disneyworld. This is the difference between Disneyland and Disneyworld.