0
The difference between 2-hexene and 3-hexene lies in the position of the double bond in the hexene molecule. In 2-hexene, the double bond is located on the second carbon atom of the hexane chain, while in 3-hexene, the double bond is located on the third carbon atom of the hexane chain.
Add your answer:
Earn +20 pts
How much difference between 2oz and 1.69 oz?
The difference between 2 oz and 1.69 oz is 0.31 oz.
What is the difference between 102 and 103?
well, 102 is 1 less then 103, there different numbers
What is the difference between a chalkboard and a blackboard?
There is no difference between a chalkboard and a blackboard; they are two different terms used interchangeably to refer to a smooth, dark surface on which you can write with chalk.
If the difference in electronegativity between two atoms is between 0 and 0.5 the bond formed is?
The bond formed is nonpolar covalent if the difference in electronegativity between two atoms is between 0 and 0.5. This means that the electrons are shared equally between the atoms in the bond.
What determines the type of bond that forms between atoms or compounds?
The type of bond that forms between atoms or compounds is determined by the electronegativity difference between the atoms involved in the bond. If the electronegativity difference is small, a covalent bond forms, where electrons are shared. If the electronegativity difference is large, an ionic bond forms, where electrons are transferred.
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
What is difference between as on and as at?
difference between as on and as at
What are the differences between California and Florida?
What is the difference between Florida and California What is the difference between Florida and California
What is the difference between physician and doctor?
what's the difference between physician and doctorwhat's the difference between physician and doctor what's the difference between physician and doctor
What difference between paging?
Difference between paging and what?
What is the difference between a samurai and shogun?
The difference between a shogun and a samurai is like the difference between a king and a knight.
What is the difference between an enterprise and association what is the difference between an pvt ltd and ltd?
difference between enterprise and corporation
What is the difference between an enterprise and association what is the difference between an pvt ltd and ltd.?
difference between enterprise and corporation
What is the difference between difference and difference?
just difference
What is the difference between the 1993 Honda accord?
Difference between it and what?
What is the difference between polyethylene and polyester?
what is the main difference between polyethylene and polyesters what is the main difference between polyethylene and polyesters
What is the difference between disneyworld and Disneyland?
The difference between Disneyland and Disneyworld is that Disneyland is in California and Florida is in Disneyworld. This is the difference between Disneyland and Disneyworld.
