0
What else can I help you with?
How much difference between 2oz and 1.69 oz?
The difference between 2 oz and 1.69 oz is 0.31 oz.
What is the difference in weight between platinum and gold?
The difference in weight between platinum and gold is that platinum is denser and heavier than gold.
What is the difference between 102 and 103?
well, 102 is 1 less then 103, there different numbers
What type of bond exists between atoms when the difference in electronegativity is 0.9?
When the difference in electronegativity between atoms is 0.9, a polar covalent bond exists.
What is the difference between a chalkboard and a blackboard?
There is no difference between a chalkboard and a blackboard; they are two different terms used interchangeably to refer to a smooth, dark surface on which you can write with chalk.
What is the chemical formula for 2-methyl-2hexene?
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
What is difference between as on and as at?
difference between as on and as at
What are the differences between California and Florida?
What is the difference between Florida and California What is the difference between Florida and California
What is the difference between physician and doctor?
what's the difference between physician and doctorwhat's the difference between physician and doctor what's the difference between physician and doctor
What difference between paging?
Difference between paging and what?
What is the difference between difference and difference?
just difference
What is the difference between an enterprise and association what is the difference between an pvt ltd and ltd.?
difference between enterprise and corporation
What is the difference between a samurai and shogun?
The difference between a shogun and a samurai is like the difference between a king and a knight.
What is the difference between an enterprise and association what is the difference between an pvt ltd and ltd?
difference between enterprise and corporation
What is the difference between the 1993 Honda accord?
Difference between it and what?
What is the difference between polyethylene and polyester?
what is the main difference between polyethylene and polyesters what is the main difference between polyethylene and polyesters
What is the difference between disneyworld and Disneyland?
The difference between Disneyland and Disneyworld is that Disneyland is in California and Florida is in Disneyworld. This is the difference between Disneyland and Disneyworld.
