The position of double bond is different. CH3-CH=CH-CH2-CH2-CH3 is 2-hexene CH3-CH2-CH=CH-CH2-CH3 is 3-hexene
The difference between 2 oz and 1.69 oz is 0.31 oz.
The difference in weight between platinum and gold is that platinum is denser and heavier than gold.
well, 102 is 1 less then 103, there different numbers
There is no difference between a chalkboard and a blackboard; they are two different terms used interchangeably to refer to a smooth, dark surface on which you can write with chalk.
When the difference in electronegativity between atoms is 0.9, a polar covalent bond exists.
A semi-structural formula for this molecule is CH3-(CH2)2-CH=C(CH3)-CH3.
difference between as on and as at
What is the difference between Florida and California What is the difference between Florida and California
what's the difference between physician and doctorwhat's the difference between physician and doctor what's the difference between physician and doctor
Difference between paging and what?
The answer of difference
difference between enterprise and corporation
difference between enterprise and corporation
The difference between a shogun and a samurai is like the difference between a king and a knight.
The difference between Disneyland and Disneyworld is that Disneyland is in California and Florida is in Disneyworld. This is the difference between Disneyland and Disneyworld.
what is the main difference between polyethylene and polyesters what is the main difference between polyethylene and polyesters
Difference between it and what?