0
It's not the alcohol itself which makes a person "fatty", it's the fact that when you eat and then consume larger amounts of alcohol, your liver prioritizes to break that down the alcohol rather then the food you have just eaten seeing it as alcohol is toxic. Your body will then store the carbohydrates not broken down by the liver as fat.
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Is cetyl alcohol drying to hair if it's an alcohol?
No, it is a fatty alcohol.
Does Glycerol have fatty acids?
No, it's an alcohol.
Are esterified fatty acids related to female hormones?
No. Fatty acids become esterified after interaction with an alcohol.
What happens when you eat fatty foods before intake of alcohol?
You need much more alcohol to get drunk. It is most cost effective to drink before (or instead of) eating. Consumption of fatty meals after excessive alcohol intake does not generally annul the effects of alcohol.
Alcohol in a triglyceride that three fatty acid chains attach to?
Triglycerides = 3 fatty acids + glycerolGlycerol (also named glycerin or glycerine) has the structural formula of:HOCH2-CH2-CH(OH)-CH2-CH2OHAnd thus you can see the three alcohol groups to which the fatty acid chains are attached to.
What kind of lifestyle that can make stroke?
A life with stress, fatty food and alcohol.
The use of alcohol build up fatty tissue in the heart muscle?
True.
What is phosphoglycerides?
if you mean the structure, then its two fatty acids, glycerol , and phosphorylated alcohol.
Which foods help keep alcohol in the stomach longer?
Fatty and oily foods.
How much alcohol makes your breath smell?
One regular drink containing an ounce of alcohol will make your breath smell.
What is a simple molecule composed of?
Glycerol,which is a simple a trifunctional alcohol, and 3 fatty acids. <
Does coffee makes us fatty?
cause it does Isabella
