0
Cyclohexane which is a cycloalkanes, has a structural formula of C6H12. It may be written in a condensed form as (CH2)6.
Wiki User
∙ 10y ago
Add your answer:
Earn +20 pts
What is the condensed structural formula for N Methylaniline?
The condensed structural formula for N-methylaniline is CH3C6H4NH2.
What is the condensed structural formula for 22 dimethylbutane?
The condensed structural formula for 2,2-dimethylbutane is CH3C(CH3)2CH2CH3.
What is the condensed structural formula of pentyl acetate?
The condensed structural formula of pentyl acetate is CH3COO(CH2)4CH3.
What is the condensed structural formula for 4-decene?
The condensed structural formula for 4-decene is CH3(CH2)8CH=CH2.
What is the condensed structural formula for methyl acetate?
The condensed structural formula for methyl acetate is CH3COOCH3.
How does a complete structural formula differ from condensed formula?
The complete or full structural formula shows all the atoms and their bonds separately. The condensed structural formula shows the atoms present but does not show the bonds.
Condensed structural formula of methyl propyl ether?
The condensed structural formula of methyl propyl ether is CH3OCH2CH2CH3.
What is the condensed stuctural formula for ethanol?
The condensed structural formula for ethanol is CH3CH2OH.
What is the condensed structural formula of hexyl acetate?
The condensed structural formula of hexyl acetate is: CH3COO(CH2)5CH3
What is the difference between structural and condensed formula?
The structural formula show the position of atoms in a molecule.
What is the correct condensed structural formula for 1-pentene?
The condensed structural formula for 1-pentene is CH3CH2CH=CHCH3.
What is the condensed structural formula for 1 3-dimethylcyclohexane?
The condensed structural formula for 1,3-dimethylcyclohexane is CH3-CH(CH3)-CH2-CH2-CH2-CH2.
