0
- The specific chemical structure of oils vary, but they all follow the same basic patterns. They are called triglycerides, because they are made of a glycerol molecule bonded with three hydrocarbon chains, called fatty acids. Although, there are rare cases when triglycerides break down, often through cooking, and become diglycerides, or monoglycerides, with only two or one fatty acid per glycerol molecule.
- Cannot be specified without knowing source. All oils are mixtures of different hydrocarbons, some linear, some rings, some saturated, some unsaturated, some have non-hydrocarbon side groups attached, some are crosslinked, etc.
Olive oil is a triacylglyceride (three (3) fatty acids attached to a glycerol base), a type of glycerolipid. Olive oil is primarily three
Oleic acid is monounsaturated and makes up 55-85% of olive oil (C17H35COOH)or CH3-(CH2)7-CH=CH-(CH2)7-COOH also known as oleate.
The scructure of vegetable oil has carbon and hydrogen atoms joined. This makes a diagram which looks like the one below.
Add your answer:
Earn +20 pts
What is the chemical structure name for oil?
Oil is a complex mixture of organic compounds.
What is the chemical structure of cocoa oil of?
See the links below.
Is oil a mineral?
Oil does not meet the definition of a mineral, i.e., a solid, definite chemical formula, formed by nature, with a crystalline structure.
What is similar in chemical structure to testosterone?
Chemical structure is more stronger than testosterone structure is testostrone is weaker than chemical structure.
What is the chemical structure of reactive dye?
chemical structure of remazol
What is the chemical structure formula for spearmint?
The chemical structure formula for spearmint essential oil is C10H14O, with the main component being carvone. Carvone is responsible for the characteristic minty aroma of spearmint.
Is DNA is chemical not a structure?
DNA is a complex chemical with a double-helix structure.
How does oil obtain energy?
Oil contains chemical energy stored in its molecular structure. When oil is burned, it releases this energy in the form of heat and light. This energy can then be harnessed to generate electricity or power vehicles.
What is the chemical structure of Nylon 66?
the chemical structure of nylon is weed and destanees bum
What is the chemical structure of cetaryl isononanoate?
There is no such chemical.
What is chemical structure of corn gluten meal?
what is the chemical structure of corn gluyen and corn starch?
Is oil a chemical?
Yes, its a chemical.
