0
What effect does the addition of NaOH have on the concentration of H?
Wiki User
∙ 13y ago
say for example the equilibrium I2(aq)+H2O(l)-----HOI(aq)+I(aq)+H(aq)
Think Lechatlier principle... addition of NaOH will cause the H ions to react with the OH ions to cause more water (more reactants) increase in reactants shifts the equilibrium in the FORWARD direction to form MORE H+ to restore the equilibrium
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
Effect on H concentration in a solution in base?
a base would decrease the ph or hydrogen concentration
Which type of chemical substance lowers the H concentration in a solution?
A base or alkaline substance lowers the H (hydrogen ion) concentration in a solution. Bases can accept or remove hydrogen ions from the solution, increasing the concentration of OH- ions and thereby reducing the concentration of H+ ions. Examples of bases include sodium hydroxide (NaOH) and ammonia (NH3).
Does NaOH contains H plus ions?
NaOH in pure state does not contain H+ ions but in solution state it does contain
What is H ion concentration of ph11?
The following equation will get you to the answer where [H+] is the concentration of hydrogen ion: pH = -log( [H+] ) or [H+] = 10-pH
How would the equilibrium concentration of H½O be affected by removing H½ from the mixture?
concentration decreases
How do you find out the pH of sodium hydroxide?
Use the working definition of pH used in General Chemistry classes: pH = -log([H+]) and the equilibrium constant for ionization of water: [H+][OH-]=10-14 (Here [] denotes concentration in Molarity) For moderate concentrations of NaOH (like 10-4-ish M and up, we can neglect the [OH-] from the actual ionization of water (since 10-7 is the maximum this concentration could be, when the NaOH concentration is 0, and even this is much less than the concentration of NaOH). Then we can say: 10-14=[H+][OH-]=[H+][NaOH] and then pH=-log[H+]=-log(10-14/[NaOH]) Just as an example, a 0.5 M solution has a pH of approximately -log(10-14/0.5) which is about 13
How does the concentration of H plus and OH- ions determine pH?
pH = - log([H+]) , pOH = - log([OH-] , pH + pOH = 14 [X] = concentration of X
Effect on H concentration in a solution in base?
a base would decrease the ph or hydrogen concentration
What is the effect of dilution on the pH of NaOH?
pH would decrease since H+ concentration increases, while pOH would increase since OH- concentration decreases. But pH would always be above 7 and pOH would always be below 7 since H+ will never be equal to OH- [OH-] would be always be greater than [H+] in any solution of NaOH , however dilute. Also remember pH + pOH =14, thus if pH decreases then pOH increases. Thanking you Yours Rajiv
What is the concentration of hydrogen ions in a 0.0010M aqueous solution of NaOH?
[h+]=1 * 10-2[h+][oh-]=1 * 10-14[oh-]=1 * 10-12
Which type of chemical substance lowers the H concentration in a solution?
A base or alkaline substance lowers the H (hydrogen ion) concentration in a solution. Bases can accept or remove hydrogen ions from the solution, increasing the concentration of OH- ions and thereby reducing the concentration of H+ ions. Examples of bases include sodium hydroxide (NaOH) and ammonia (NH3).
If you add hydrochloric acid to water what effect would it have on the H plus concentration on the pH?
Hydrochloric acid is HCl. It is a H plus (H^+) donor, and so adding it to water will INCREASE the H^+ concentration. Increasing the H^+ concentration results in a DECREASE in pH.
What is the formula for aldehyde plus NaOH?
2H - C - H + NaOH ------> H- C - O -Na + CH3 - OH
Does NaOH contains H plus ions?
NaOH in pure state does not contain H+ ions but in solution state it does contain
Would NaCl dissolve in water and form an acid?
No, there wouldn't be any measurable effect on the pH of the solution.The only way to affect the pH of the aqueous solution would be changing its proportion of OH- and "H+". At room temperature the concentration of these two species is 10^-7 mol/l and the product of both concentrations must always be 10^-14 mol²/l² at these conditions.Consequently a change in the concentration of one of these ions would affect the concentration of the other. This could be achieved by binding either OH- to Na+ or "H+" to Cl-. Binding OH- to Na+ would rise the concentration of "H+" and by this leading to an acidic character of the solution.Since NaOH is a very strong base and HCl is a very strong acid, both dissolve completely in water to Na+ (aq), OH-, Cl- (aq) and "H+". No chemically bound NaOH or HCl in the solution is observable and no change in the ("H+"/OH-)-ratio occurs. Thus the pH stays the same.
How do the concentrations of hydrogen ion and hydroxide ion determine whether a solution is acidic basic or neutral.?
acids are substances that release their hydrogen ion(s) while bases grab hydrogen ions to themselves. SO, adding acids will increase the H+ concentration while adding bases will decrease the H+ concetration of the solution. This would be considered a direct effect.
What is molarity poh and pH of 4.50G of NaOH if diluted in up to 750 ml of H2O?
MW NaOH is 23+16+1 = 40. 4.5g in 750ml is 6.0g in 1L. Molarity is 6/40 = 0.15 OH- concentration is 0.15, pOH is -log100.15 = 0.82 H+ concentration is 10-14/0.15 = 6.67x10-13 pH is -log10 6.67x10-13 = 12.18
