0
CH3 is not a chemical equation, it is a chemical formula. CH3 is a methyl but, it can not be on its own.
Wiki User
∙ 9y ago
Add your answer:
Earn +20 pts
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is the chemical formula of rubbing alcohol ispropyl?
Ch3-choh-ch3
What is the chemical formula for methylbutane?
The chemical formula of methylbutane is C4H9-CH3.
What is the chemical formula of dimethyl hydrazine?
(CH3)2NNH2
What is dimethyfuran?
The chemical formula of dimethylfuran is (CH3)2C4H2O.
How will convert methanol into ethanoic acid.write chemical equation?
By hydrogenation ( CH3-CH3+H2=>CH3COOH)
What is the chemical equation for the reaction that occurs when you add NaOH solution to a CH3CO2-NaCH3CO2 buffer solution?
The chemical reaction is: 4 H3BO3 + 2 NaOH = Na2B4O7 + 7 H2O
What is the chemical equation for octyl acetate?
Ch3co2h + ch3(ch2)7oh ---- ch3coo(ch2)7ch3 + h2o
What is the reaction equation of 1-butene and water?
Ch2=ch-ch2-ch3 + h2 = ch3-ch2-ch2-ch3
What is the balance equation for the addition of sodium bisulfate to acetone?
CH3 - C - CH3 + NaHSO3 ------> CH3 - C -OH
What is CH3?
Hi, CH3 is chemical formula of methyl group.
What is the equation of 2 iodohexane with sodium methoixde?
CH3-CH(I)-CH2-CH2-CH2-CH3 + CH3-ONa --------> CH3-CH(O-CH3)-CH2-CH2-CH2-CH3 + NaI
What is the chemical formula of rubbing alcohol ispropyl?
Ch3-choh-ch3
The equation for the reaction between 2-pentene and bromine?
CH3-CH=CH-CH2-CH3 + Br2 = CH3-CH(Br)-CH(Br)-CH2-CH3
Chemical equation of ethanol?
This reaction depends upon ratio of both the reactants, ethanol with a largequantity of concentrated sulphuric acid on heating produces ethene. CH3-CH2-OH = CH2=CH2 + H2O But if ethanol is in excess then Diethyl ether is formed. 2CH3-CH2-OH = CH3-CH2-O-CH2-CH3 + H2O
What is the balanced chemical equation for the burning of ethanol?
C2H5OH +3O2 gives 2CO2 +3H2O ...it burns with ablue flame in air
How do you write a balanced equation for 22-dimethylbutane?
You don't. An equation can only be written for a reaction, not an individual substance. Perhaps you mean what is the formula? It is CH3(CH3)2CH2CH3 or C6H14 .
